C15H23FN2 — CID 113447257
N-[(3-ethylcyclopentyl)-(3-fluoro-4-pyridinyl)methyl]ethanamine (PubChem CID 113447257) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is N-[(3-ethylcyclopentyl)-(3-fluoro-4-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(3-ethylcyclopentyl)-(3-fluoro-4-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 113447257 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[(3-ethylcyclopentyl)-(3-fluoro-4-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1ccncc1F)C1CCC(CC)C1 |
| InChI | InChI=1S/C15H23FN2/c1-3-11-5-6-12(9-11)15(18-4-2)13-7-8-17-10-14(13)16/h7-8,10-12,15,18H,3-6,9H2,1-2H3 |
| InChIKey | PNHIVQHYGGHORK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |