C17H26FN — CID 65410648
N-[(3-ethylcyclopentyl)-(2-fluorophenyl)methyl]propan-1-amine (PubChem CID 65410648) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is N-[(3-ethylcyclopentyl)-(2-fluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-ethylcyclopentyl)-(2-fluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 65410648 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N-[(3-ethylcyclopentyl)-(2-fluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccccc1F)C1CCC(CC)C1 |
| InChI | InChI=1S/C17H26FN/c1-3-11-19-17(14-10-9-13(4-2)12-14)15-7-5-6-8-16(15)18/h5-8,13-14,17,19H,3-4,9-12H2,1-2H3 |
| InChIKey | WXEIUNHSNMCDLZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |