C13H19FN2S — CID 113447287
N-[(3-fluoro-4-pyridinyl)-(thian-2-yl)methyl]ethanamine (PubChem CID 113447287) has the molecular formula C13H19FN2S and a molecular weight of 254.37 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)-(thian-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-fluoro-4-pyridinyl)-(thian-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 113447287 |
| Molecular Formula | C13H19FN2S |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)-(thian-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccncc1F)C1CCCCS1 |
| InChI | InChI=1S/C13H19FN2S/c1-2-16-13(12-5-3-4-8-17-12)10-6-7-15-9-11(10)14/h6-7,9,12-13,16H,2-5,8H2,1H3 |
| InChIKey | TYWPGCYGAAODKC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |