C15H23NS — CID 80622039
N-[(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]ethanamine (PubChem CID 80622039) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]ethanamine.
| Compound Name | N-[(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80622039 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-[(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C)cc1C)C1CCCS1 |
| InChI | InChI=1S/C15H23NS/c1-4-16-15(14-6-5-9-17-14)13-8-7-11(2)10-12(13)3/h7-8,10,14-16H,4-6,9H2,1-3H3 |
| InChIKey | DQEWBRCCMNCWOW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |