C13H20N2S — CID 105255377
[(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]hydrazine (PubChem CID 105255377) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is [(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]hydrazine.
| Compound Name | [(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255377 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [(2,4-dimethylphenyl)-(thiolan-2-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)C2CCCS2)c(C)c1 |
| InChI | InChI=1S/C13H20N2S/c1-9-5-6-11(10(2)8-9)13(15-14)12-4-3-7-16-12/h5-6,8,12-13,15H,3-4,7,14H2,1-2H3 |
| InChIKey | LYLDPVASXUBMMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|