C12H17FN2S — CID 105255383
[(4-fluoro-2-methylphenyl)-(thiolan-2-yl)methyl]hydrazine (PubChem CID 105255383) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is [(4-fluoro-2-methylphenyl)-(thiolan-2-yl)methyl]hydrazine.
| Compound Name | [(4-fluoro-2-methylphenyl)-(thiolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255383 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [(4-fluoro-2-methylphenyl)-(thiolan-2-yl)methyl]hydrazine |
| SMILES | Cc1cc(F)ccc1C(NN)C1CCCS1 |
| InChI | InChI=1S/C12H17FN2S/c1-8-7-9(13)4-5-10(8)12(15-14)11-3-2-6-16-11/h4-5,7,11-12,15H,2-3,6,14H2,1H3 |
| InChIKey | SEXBYPWCWLZJIB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|