C11H12BrF2NS — CID 106942888
(3-bromo-2,6-difluorophenyl)-(thiolan-2-yl)methanamine (PubChem CID 106942888) has the molecular formula C11H12BrF2NS and a molecular weight of 308.19 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(thiolan-2-yl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(thiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 106942888 |
| Molecular Formula | C11H12BrF2NS |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(thiolan-2-yl)methanamine |
| SMILES | NC(c1c(F)ccc(Br)c1F)C1CCCS1 |
| InChI | InChI=1S/C11H12BrF2NS/c12-6-3-4-7(13)9(10(6)14)11(15)8-2-1-5-16-8/h3-4,8,11H,1-2,5,15H2 |
| InChIKey | PJPXKJOTDHYRSA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|