C16H14BrF2N — CID 106942637
(3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanamine (PubChem CID 106942637) has the molecular formula C16H14BrF2N and a molecular weight of 338.20 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanamine |
|---|---|
| PubChem CID | 106942637 |
| Molecular Formula | C16H14BrF2N |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanamine |
| SMILES | NC(c1c(F)ccc(Br)c1F)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H14BrF2N/c17-12-5-6-13(18)14(15(12)19)16(20)11-7-9-3-1-2-4-10(9)8-11/h1-6,11,16H,7-8,20H2 |
| InChIKey | FZYBGEDGEODZGO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|