C13H14BrF4N — CID 106944847
(3-bromo-2,6-difluorophenyl)-(4,4-difluorocyclohexyl)methanamine (PubChem CID 106944847) has the molecular formula C13H14BrF4N and a molecular weight of 340.16 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(4,4-difluorocyclohexyl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(4,4-difluorocyclohexyl)methanamine |
|---|---|
| PubChem CID | 106944847 |
| Molecular Formula | C13H14BrF4N |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(4,4-difluorocyclohexyl)methanamine |
| SMILES | NC(c1c(F)ccc(Br)c1F)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H14BrF4N/c14-8-1-2-9(15)10(11(8)16)12(19)7-3-5-13(17,18)6-4-7/h1-2,7,12H,3-6,19H2 |
| InChIKey | PLEVASVTMDMTKQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|