C15H20BrF2N — CID 106942605
(3-bromo-2,6-difluorophenyl)-(4,4-dimethylcyclohexyl)methanamine (PubChem CID 106942605) has the molecular formula C15H20BrF2N and a molecular weight of 332.23 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(4,4-dimethylcyclohexyl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(4,4-dimethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 106942605 |
| Molecular Formula | C15H20BrF2N |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(4,4-dimethylcyclohexyl)methanamine |
| SMILES | CC1(C)CCC(C(N)c2c(F)ccc(Br)c2F)CC1 |
| InChI | InChI=1S/C15H20BrF2N/c1-15(2)7-5-9(6-8-15)14(19)12-11(17)4-3-10(16)13(12)18/h3-4,9,14H,5-8,19H2,1-2H3 |
| InChIKey | PFPNNSABMUEBCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|