C12H16BrClFNO — CID 171253038
2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-fluorophenol;hydrochloride (PubChem CID 171253038) has the molecular formula C12H16BrClFNO and a molecular weight of 324.62 g/mol. Its IUPAC name is 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-fluorophenol;hydrochloride.
| Compound Name | 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171253038 |
| Molecular Formula | C12H16BrClFNO |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-[(S)-amino(cyclopentyl)methyl]-3-bromo-6-fluorophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1c(Br)ccc(F)c1O)C1CCCC1 |
| InChI | InChI=1S/C12H15BrFNO.ClH/c13-8-5-6-9(14)12(16)10(8)11(15)7-3-1-2-4-7;/h5-7,11,16H,1-4,15H2;1H/t11-;/m0./s1 |
| InChIKey | APPZJKZBUDKGKB-MERQFXBCSA-N |
| XLogP | 3.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|