C11H12F3N — CID 65422564
(2-methylcyclopropyl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 65422564) has the molecular formula C11H12F3N and a molecular weight of 215.22 g/mol. Its IUPAC name is (2-methylcyclopropyl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (2-methylcyclopropyl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 65422564 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (2-methylcyclopropyl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CC1CC1C(N)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H12F3N/c1-5-4-7(5)11(15)6-2-3-8(12)10(14)9(6)13/h2-3,5,7,11H,4,15H2,1H3 |
| InChIKey | CZTBSDBIUVPUAG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|