C12H14F3NO — CID 171248262
(R)-oxan-4-yl-(2,3,4-trifluorophenyl)methanamine (PubChem CID 171248262) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is (R)-oxan-4-yl-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (R)-oxan-4-yl-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 171248262 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (R)-oxan-4-yl-(2,3,4-trifluorophenyl)methanamine |
| SMILES | N[C@@H](c1ccc(F)c(F)c1F)C1CCOCC1 |
| InChI | InChI=1S/C12H14F3NO/c13-9-2-1-8(10(14)11(9)15)12(16)7-3-5-17-6-4-7/h1-2,7,12H,3-6,16H2/t12-/m1/s1 |
| InChIKey | MPMSXXZNIDWWGW-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|