C12H16ClF2NO — CID 171241038
(S)-(2,3-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171241038) has the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. Its IUPAC name is (S)-(2,3-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-(2,3-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171241038 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (S)-(2,3-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(F)c1F)C1CCOCC1 |
| InChI | InChI=1S/C12H15F2NO.ClH/c13-10-3-1-2-9(11(10)14)12(15)8-4-6-16-7-5-8;/h1-3,8,12H,4-7,15H2;1H/t12-;/m0./s1 |
| InChIKey | IRARFCUPFASDOP-YDALLXLXSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |