C11H11F3O2 — CID 63893972
oxolan-3-yl-(2,3,4-trifluorophenyl)methanol (PubChem CID 63893972) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is oxolan-3-yl-(2,3,4-trifluorophenyl)methanol.
| Compound Name | oxolan-3-yl-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 63893972 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | oxolan-3-yl-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1F)C1CCOC1 |
| InChI | InChI=1S/C11H11F3O2/c12-8-2-1-7(9(13)10(8)14)11(15)6-3-4-16-5-6/h1-2,6,11,15H,3-5H2 |
| InChIKey | YFDLYYNEGSYPCW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|