C11H11F3O2 — CID 61277498
oxolan-3-yl-(2,4,6-trifluorophenyl)methanol (PubChem CID 61277498) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is oxolan-3-yl-(2,4,6-trifluorophenyl)methanol.
| Compound Name | oxolan-3-yl-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 61277498 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | oxolan-3-yl-(2,4,6-trifluorophenyl)methanol |
| SMILES | OC(c1c(F)cc(F)cc1F)C1CCOC1 |
| InChI | InChI=1S/C11H11F3O2/c12-7-3-8(13)10(9(14)4-7)11(15)6-1-2-16-5-6/h3-4,6,11,15H,1-2,5H2 |
| InChIKey | NKKMOFUGKCTHRI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |