C13H16ClFO — CID 106879708
3-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]oxolane (PubChem CID 106879708) has the molecular formula C13H16ClFO and a molecular weight of 242.72 g/mol. Its IUPAC name is 3-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]oxolane.
| Compound Name | 3-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 106879708 |
| Molecular Formula | C13H16ClFO |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]oxolane |
| SMILES | Cc1cc(F)cc(C)c1C(Cl)C1CCOC1 |
| InChI | InChI=1S/C13H16ClFO/c1-8-5-11(15)6-9(2)12(8)13(14)10-3-4-16-7-10/h5-6,10,13H,3-4,7H2,1-2H3 |
| InChIKey | UXHKCXKIEMBMBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|