About (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol
(2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 79763149) has the molecular formula C12H13F3O2
and a molecular weight of 246.23 g/mol. Its IUPAC name is (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol.
Molecular Properties
| Compound Name | (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol |
| PubChem CID | 79763149 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | CC1OCCC1C(O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H13F3O2/c1-6-8(2-3-17-6)12(16)11-9(14)4-7(13)5-10(11)15/h4-6,8,12,16H,2-3H2,1H3 |
| InChIKey | LIEKHPXNRQJJLO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol?
The IUPAC name of (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol (CID 79763149) is (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol.
What is the SMILES notation for (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol?
The canonical SMILES for (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol is CC1OCCC1C(O)c1c(F)cc(F)cc1F.
What is the InChIKey of (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol?
The InChIKey is LIEKHPXNRQJJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O2/c1-6-8(2-3-17-6)12(16)11-9(14)4-7(13)5-10(11)15/h4-6,8,12,16H,2-3H2,1H3.
What are the key properties of (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol?
(2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol has a molecular weight of 246.23 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol is sourced from PubChem (CID 79763149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).