C12H13F3O2 — CID 79763149
(2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 79763149) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 79763149 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2-methyloxolan-3-yl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | CC1OCCC1C(O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H13F3O2/c1-6-8(2-3-17-6)12(16)11-9(14)4-7(13)5-10(11)15/h4-6,8,12,16H,2-3H2,1H3 |
| InChIKey | LIEKHPXNRQJJLO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |