C16H21F3O — CID 65425286
(4-propan-2-ylcyclohexyl)-(2,3,4-trifluorophenyl)methanol (PubChem CID 65425286) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is (4-propan-2-ylcyclohexyl)-(2,3,4-trifluorophenyl)methanol.
| Compound Name | (4-propan-2-ylcyclohexyl)-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 65425286 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (4-propan-2-ylcyclohexyl)-(2,3,4-trifluorophenyl)methanol |
| SMILES | CC(C)C1CCC(C(O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H21F3O/c1-9(2)10-3-5-11(6-4-10)16(20)12-7-8-13(17)15(19)14(12)18/h7-11,16,20H,3-6H2,1-2H3 |
| InChIKey | ODOOJNAJNRJXLH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|