C14H17F3O — CID 115797110
3-cyclopentyl-1-(2,3,4-trifluorophenyl)propan-1-ol (PubChem CID 115797110) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,3,4-trifluorophenyl)propan-1-ol.
| Compound Name | 3-cyclopentyl-1-(2,3,4-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 115797110 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-cyclopentyl-1-(2,3,4-trifluorophenyl)propan-1-ol |
| SMILES | OC(CCC1CCCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3O/c15-11-7-6-10(13(16)14(11)17)12(18)8-5-9-3-1-2-4-9/h6-7,9,12,18H,1-5,8H2 |
| InChIKey | GDQIXYAXNHHYOM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|