C14H17F3O2 — CID 115797020
3-(oxan-2-yl)-1-(2,3,4-trifluorophenyl)propan-1-ol (PubChem CID 115797020) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-(oxan-2-yl)-1-(2,3,4-trifluorophenyl)propan-1-ol.
| Compound Name | 3-(oxan-2-yl)-1-(2,3,4-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 115797020 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-(oxan-2-yl)-1-(2,3,4-trifluorophenyl)propan-1-ol |
| SMILES | OC(CCC1CCCCO1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3O2/c15-11-6-5-10(13(16)14(11)17)12(18)7-4-9-3-1-2-8-19-9/h5-6,9,12,18H,1-4,7-8H2 |
| InChIKey | UQDNBMXYSIWNCX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|