C14H18F2O2 — CID 79730679
1-(2,4-difluoro-5-methylphenyl)-3-(oxolan-2-yl)propan-1-ol (PubChem CID 79730679) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-3-(oxolan-2-yl)propan-1-ol.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-3-(oxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79730679 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-3-(oxolan-2-yl)propan-1-ol |
| SMILES | Cc1cc(C(O)CCC2CCCO2)c(F)cc1F |
| InChI | InChI=1S/C14H18F2O2/c1-9-7-11(13(16)8-12(9)15)14(17)5-4-10-3-2-6-18-10/h7-8,10,14,17H,2-6H2,1H3 |
| InChIKey | SLJRDFVCNNVXKG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |