C12H16Br2O2S — CID 63952380
1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-ol (PubChem CID 63952380) has the molecular formula C12H16Br2O2S and a molecular weight of 384.13 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 63952380 |
| Molecular Formula | C12H16Br2O2S |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-ol |
| SMILES | OC(CCC1CCCCO1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H16Br2O2S/c13-11-7-9(12(14)17-11)10(15)5-4-8-3-1-2-6-16-8/h7-8,10,15H,1-6H2 |
| InChIKey | UJJDYSOUEJAZGS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |