C12H17Br2NOS — CID 63951729
1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-amine (PubChem CID 63951729) has the molecular formula C12H17Br2NOS and a molecular weight of 383.15 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 63951729 |
| Molecular Formula | C12H17Br2NOS |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-3-(oxan-2-yl)propan-1-amine |
| SMILES | NC(CCC1CCCCO1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H17Br2NOS/c13-11-7-9(12(14)17-11)10(15)5-4-8-3-1-2-6-16-8/h7-8,10H,1-6,15H2 |
| InChIKey | AFMWYTZGDHKPDY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |