C13H17F3O — CID 115829925
5-methyl-1-(2,3,4-trifluorophenyl)hexan-1-ol (PubChem CID 115829925) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-methyl-1-(2,3,4-trifluorophenyl)hexan-1-ol.
| Compound Name | 5-methyl-1-(2,3,4-trifluorophenyl)hexan-1-ol |
|---|---|
| PubChem CID | 115829925 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5-methyl-1-(2,3,4-trifluorophenyl)hexan-1-ol |
| SMILES | CC(C)CCCC(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H17F3O/c1-8(2)4-3-5-11(17)9-6-7-10(14)13(16)12(9)15/h6-8,11,17H,3-5H2,1-2H3 |
| InChIKey | GAXDJJLBKNOIIK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|