C15H22F3N — CID 55186996
4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine (PubChem CID 55186996) has the molecular formula C15H22F3N and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine.
| Compound Name | 4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 55186996 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-methyl-N-propyl-1-(2,3,4-trifluorophenyl)pentan-1-amine |
| SMILES | CCCNC(CCC(C)C)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H22F3N/c1-4-9-19-13(8-5-10(2)3)11-6-7-12(16)15(18)14(11)17/h6-7,10,13,19H,4-5,8-9H2,1-3H3 |
| InChIKey | AJNXKWYJBBGYEU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|