C16H23FO2 — CID 82808519
cyclooctyl-(2-fluoro-3-methoxyphenyl)methanol (PubChem CID 82808519) has the molecular formula C16H23FO2 and a molecular weight of 266.36 g/mol. Its IUPAC name is cyclooctyl-(2-fluoro-3-methoxyphenyl)methanol.
| Compound Name | cyclooctyl-(2-fluoro-3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 82808519 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | cyclooctyl-(2-fluoro-3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)C2CCCCCCC2)c1F |
| InChI | InChI=1S/C16H23FO2/c1-19-14-11-7-10-13(15(14)17)16(18)12-8-5-3-2-4-6-9-12/h7,10-12,16,18H,2-6,8-9H2,1H3 |
| InChIKey | PJCDHQWKIRNRKF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |