C14H17FO2 — CID 82805925
cyclohex-3-en-1-yl-(2-fluoro-3-methoxyphenyl)methanol (PubChem CID 82805925) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(2-fluoro-3-methoxyphenyl)methanol.
| Compound Name | cyclohex-3-en-1-yl-(2-fluoro-3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 82805925 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | cyclohex-3-en-1-yl-(2-fluoro-3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)C2CC=CCC2)c1F |
| InChI | InChI=1S/C14H17FO2/c1-17-12-9-5-8-11(13(12)15)14(16)10-6-3-2-4-7-10/h2-3,5,8-10,14,16H,4,6-7H2,1H3 |
| InChIKey | QOXLHPOYGCPIQH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|