C14H17F3O2 — CID 62790469
cyclohexyl-[2-(trifluoromethoxy)phenyl]methanol (PubChem CID 62790469) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is cyclohexyl-[2-(trifluoromethoxy)phenyl]methanol.
| Compound Name | cyclohexyl-[2-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 62790469 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | cyclohexyl-[2-(trifluoromethoxy)phenyl]methanol |
| SMILES | OC(c1ccccc1OC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C14H17F3O2/c15-14(16,17)19-12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10/h4-5,8-10,13,18H,1-3,6-7H2 |
| InChIKey | PPKFAJNQJUUQNE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |