C16H21F3O2 — CID 63894152
(2-ethylcyclohexyl)-[2-(trifluoromethoxy)phenyl]methanol (PubChem CID 63894152) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is (2-ethylcyclohexyl)-[2-(trifluoromethoxy)phenyl]methanol.
| Compound Name | (2-ethylcyclohexyl)-[2-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 63894152 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2-ethylcyclohexyl)-[2-(trifluoromethoxy)phenyl]methanol |
| SMILES | CCC1CCCCC1C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H21F3O2/c1-2-11-7-3-4-8-12(11)15(20)13-9-5-6-10-14(13)21-16(17,18)19/h5-6,9-12,15,20H,2-4,7-8H2,1H3 |
| InChIKey | OKRIKFIQLCNVEG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |