C11H10F5NO — CID 155010567
(R)-(2,3,4,5,6-pentafluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol (PubChem CID 155010567) has the molecular formula C11H10F5NO and a molecular weight of 267.20 g/mol. Its IUPAC name is (R)-(2,3,4,5,6-pentafluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol.
| Compound Name | (R)-(2,3,4,5,6-pentafluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 155010567 |
| Molecular Formula | C11H10F5NO |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (R)-(2,3,4,5,6-pentafluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
| SMILES | O[C@H](c1c(F)c(F)c(F)c(F)c1F)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H10F5NO/c12-6-5(11(18)4-2-1-3-17-4)7(13)9(15)10(16)8(6)14/h4,11,17-18H,1-3H2/t4-,11-/m0/s1 |
| InChIKey | URLFCPKPZJVNTM-AUIPBDMJSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|