C6H13NO3 — CID 138712862
2-[(2S)-pyrrolidin-2-yl]ethane-1,1,2-triol (PubChem CID 138712862) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidin-2-yl]ethane-1,1,2-triol.
| Compound Name | 2-[(2S)-pyrrolidin-2-yl]ethane-1,1,2-triol |
|---|---|
| PubChem CID | 138712862 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2-[(2S)-pyrrolidin-2-yl]ethane-1,1,2-triol |
| SMILES | OC(O)C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H13NO3/c8-5(6(9)10)4-2-1-3-7-4/h4-10H,1-3H2/t4-,5?/m0/s1 |
| InChIKey | CEUGFFFXZXDUHG-ROLXFIACSA-N |
| XLogP | -1.59 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|