C9H19NO — CID 92979517
(1R)-2,2-dimethyl-1-[(2R)-pyrrolidin-2-yl]propan-1-ol (PubChem CID 92979517) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-[(2R)-pyrrolidin-2-yl]propan-1-ol.
| Compound Name | (1R)-2,2-dimethyl-1-[(2R)-pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 92979517 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (1R)-2,2-dimethyl-1-[(2R)-pyrrolidin-2-yl]propan-1-ol |
| SMILES | CC(C)(C)[C@@H](O)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H19NO/c1-9(2,3)8(11)7-5-4-6-10-7/h7-8,10-11H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | KMQGFHHTDNBHKE-SFYZADRCSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |