C12H23NO7 — CID 67373011
2-(1,2-dihydroxy-1-pyrrolidin-2-ylpropan-2-yl)oxyoxane-3,4,5-triol (PubChem CID 67373011) has the molecular formula C12H23NO7 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-1-pyrrolidin-2-ylpropan-2-yl)oxyoxane-3,4,5-triol.
| Compound Name | 2-(1,2-dihydroxy-1-pyrrolidin-2-ylpropan-2-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 67373011 |
| Molecular Formula | C12H23NO7 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(1,2-dihydroxy-1-pyrrolidin-2-ylpropan-2-yl)oxyoxane-3,4,5-triol |
| SMILES | CC(O)(OC1OCC(O)C(O)C1O)C(O)C1CCCN1 |
| InChI | InChI=1S/C12H23NO7/c1-12(18,10(17)6-3-2-4-13-6)20-11-9(16)8(15)7(14)5-19-11/h6-11,13-18H,2-5H2,1H3 |
| InChIKey | HBZNJNBQLVUGGN-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|