C13H24O10 — CID 90766018
(2S,3R,4R,5S)-2-[2-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropan-2-yloxy]oxane-3,4,5-triol (PubChem CID 90766018) has the molecular formula C13H24O10 and a molecular weight of 340.33 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[2-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropan-2-yloxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[2-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropan-2-yloxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90766018 |
| Molecular Formula | C13H24O10 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2S,3R,4R,5S)-2-[2-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropan-2-yloxy]oxane-3,4,5-triol |
| SMILES | CC(C)(O[C@@H]1OC[C@H](O)[C@@H](O)[C@H]1O)O[C@@H]1OC[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O10/c1-13(2,22-11-9(18)7(16)5(14)3-20-11)23-12-10(19)8(17)6(15)4-21-12/h5-12,14-19H,3-4H2,1-2H3/t5-,6-,7+,8+,9+,10+,11-,12-/m0/s1 |
| InChIKey | JQSNXQOXDSNAOK-NKUXFBMISA-N |
| XLogP | -3.37 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|