C8H18O5Si — CID 45093703
(3R,4S,5R)-2-trimethylsilyloxyoxane-3,4,5-triol (PubChem CID 45093703) has the molecular formula C8H18O5Si and a molecular weight of 222.31 g/mol. Its IUPAC name is (3R,4S,5R)-2-trimethylsilyloxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5R)-2-trimethylsilyloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 45093703 |
| Molecular Formula | C8H18O5Si |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3R,4S,5R)-2-trimethylsilyloxyoxane-3,4,5-triol |
| SMILES | C[Si](C)(C)OC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H18O5Si/c1-14(2,3)13-8-7(11)6(10)5(9)4-12-8/h5-11H,4H2,1-3H3/t5-,6+,7-,8?/m1/s1 |
| InChIKey | BKVGDLRCZNMWCW-MOMMNUENSA-N |
| XLogP | -0.72 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|