C13H32O4Si3 — CID 91750442
[(2S,3S,4S)-2,4-bis(trimethylsilyloxy)oxolan-3-yl]oxy-trimethylsilane (PubChem CID 91750442) has the molecular formula C13H32O4Si3 and a molecular weight of 336.65 g/mol. Its IUPAC name is [(2S,3S,4S)-2,4-bis(trimethylsilyloxy)oxolan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4S)-2,4-bis(trimethylsilyloxy)oxolan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91750442 |
| Molecular Formula | C13H32O4Si3 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(2S,3S,4S)-2,4-bis(trimethylsilyloxy)oxolan-3-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@@H]1OC[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C13H32O4Si3/c1-18(2,3)15-11-10-14-13(17-20(7,8)9)12(11)16-19(4,5)6/h11-13H,10H2,1-9H3/t11-,12-,13-/m0/s1 |
| InChIKey | VZNHGEZKVDSQOS-AVGNSLFASA-N |
| XLogP | 3.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|