C13H19NO3 — CID 135313109
(S)-(3,5-dimethoxyphenyl)-[(2R)-pyrrolidin-2-yl]methanol (PubChem CID 135313109) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (S)-(3,5-dimethoxyphenyl)-[(2R)-pyrrolidin-2-yl]methanol.
| Compound Name | (S)-(3,5-dimethoxyphenyl)-[(2R)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 135313109 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (S)-(3,5-dimethoxyphenyl)-[(2R)-pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(OC)cc([C@H](O)[C@H]2CCCN2)c1 |
| InChI | InChI=1S/C13H19NO3/c1-16-10-6-9(7-11(8-10)17-2)13(15)12-4-3-5-14-12/h6-8,12-15H,3-5H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | KMAVYRLTMHIACB-OLZOCXBDSA-N |
| XLogP | 1.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |