C9H14N2O2S — CID 130673824
(3-methoxy-1,2-thiazol-5-yl)-pyrrolidin-2-ylmethanol (PubChem CID 130673824) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (3-methoxy-1,2-thiazol-5-yl)-pyrrolidin-2-ylmethanol.
| Compound Name | (3-methoxy-1,2-thiazol-5-yl)-pyrrolidin-2-ylmethanol |
|---|---|
| PubChem CID | 130673824 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3-methoxy-1,2-thiazol-5-yl)-pyrrolidin-2-ylmethanol |
| SMILES | COc1cc(C(O)C2CCCN2)sn1 |
| InChI | InChI=1S/C9H14N2O2S/c1-13-8-5-7(14-11-8)9(12)6-3-2-4-10-6/h5-6,9-10,12H,2-4H2,1H3 |
| InChIKey | YRDCGMIBPXMUQJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |