C8H11NO2S — CID 130748192
cyclopropyl-(3-methoxy-1,2-thiazol-5-yl)methanol (PubChem CID 130748192) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is cyclopropyl-(3-methoxy-1,2-thiazol-5-yl)methanol.
| Compound Name | cyclopropyl-(3-methoxy-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130748192 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | cyclopropyl-(3-methoxy-1,2-thiazol-5-yl)methanol |
| SMILES | COc1cc(C(O)C2CC2)sn1 |
| InChI | InChI=1S/C8H11NO2S/c1-11-7-4-6(12-9-7)8(10)5-2-3-5/h4-5,8,10H,2-3H2,1H3 |
| InChIKey | JVJQMJMSVVFORT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |