C9H11NO2S — CID 126999945
3-(3-methoxy-1,2-thiazol-5-yl)cyclopent-2-en-1-ol (PubChem CID 126999945) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-(3-methoxy-1,2-thiazol-5-yl)cyclopent-2-en-1-ol.
| Compound Name | 3-(3-methoxy-1,2-thiazol-5-yl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 126999945 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 3-(3-methoxy-1,2-thiazol-5-yl)cyclopent-2-en-1-ol |
| SMILES | COc1cc(C2=CC(O)CC2)sn1 |
| InChI | InChI=1S/C9H11NO2S/c1-12-9-5-8(13-10-9)6-2-3-7(11)4-6/h4-5,7,11H,2-3H2,1H3 |
| InChIKey | OLXZWJPLSHIWAG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |