C7H11N3OS — CID 130899428
3-methoxy-N,N-dimethyl-1,2-thiazole-5-carboximidamide (PubChem CID 130899428) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethyl-1,2-thiazole-5-carboximidamide.
| Compound Name | 3-methoxy-N,N-dimethyl-1,2-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 130899428 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-methoxy-N,N-dimethyl-1,2-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(/c1cc(OC)ns1)N(C)C |
| InChI | InChI=1S/C7H11N3OS/c1-10(2)7(8)5-4-6(11-3)9-12-5/h4,8H,1-3H3/b8-7- |
| InChIKey | HZVNHTJUDDMUKH-FPLPWBNLSA-N |
| XLogP | 1.04 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|