C7H9ClN2O2S — CID 165498652
N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylcarbamoyl chloride (PubChem CID 165498652) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylcarbamoyl chloride.
| Compound Name | N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 165498652 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylcarbamoyl chloride |
| SMILES | COc1cc(CN(C)C(=O)Cl)sn1 |
| InChI | InChI=1S/C7H9ClN2O2S/c1-10(7(8)11)4-5-3-6(12-2)9-13-5/h3H,4H2,1-2H3 |
| InChIKey | BRERBLLBLXJFAF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|