C7H9ClN2O2S — CID 166405804
2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide (PubChem CID 166405804) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166405804 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CCl)sn1 |
| InChI | InChI=1S/C7H9ClN2O2S/c1-12-7-2-5(13-10-7)4-9-6(11)3-8/h2H,3-4H2,1H3,(H,9,11) |
| InChIKey | WQJRGFIEXCASJM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|