C10H15ClN2O3S — CID 166415337
2-chloro-N-(2-methoxyethyl)-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide (PubChem CID 166415337) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 166415337 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]acetamide |
| SMILES | COCCN(Cc1cc(OC)ns1)C(=O)CCl |
| InChI | InChI=1S/C10H15ClN2O3S/c1-15-4-3-13(10(14)6-11)7-8-5-9(16-2)12-17-8/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | PPTRWESRNGGFHD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|