C8H11ClN2O2S — CID 166407535
2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylacetamide (PubChem CID 166407535) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylacetamide.
| Compound Name | 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 166407535 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-chloro-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]-N-methylacetamide |
| SMILES | COc1cc(CN(C)C(=O)CCl)sn1 |
| InChI | InChI=1S/C8H11ClN2O2S/c1-11(8(12)4-9)5-6-3-7(13-2)10-14-6/h3H,4-5H2,1-2H3 |
| InChIKey | XEEFIAGRAPTJEV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|