C15H22ClNO6S — CID 42776954
[5-[[3-chloropropanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 42776954) has the molecular formula C15H22ClNO6S and a molecular weight of 379.86 g/mol. Its IUPAC name is [5-[[3-chloropropanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[3-chloropropanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 42776954 |
| Molecular Formula | C15H22ClNO6S |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [5-[[3-chloropropanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)CCCl |
| InChI | InChI=1S/C15H22ClNO6S/c1-21-9-8-17(15(18)6-7-16)11-12-4-5-13(22-2)14(10-12)23-24(3,19)20/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | HCJIXYXWOHODDV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|