C20H25NO7S — CID 4221810
[2-methoxy-5-[[2-methoxyethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4221810) has the molecular formula C20H25NO7S and a molecular weight of 423.49 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4221810 |
| Molecular Formula | C20H25NO7S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C20H25NO7S/c1-25-12-11-21(20(22)15-27-17-7-5-4-6-8-17)14-16-9-10-18(26-2)19(13-16)28-29(3,23)24/h4-10,13H,11-12,14-15H2,1-3H3 |
| InChIKey | LZMAQDCARKIYGP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|