C23H25NO6S — CID 3956678
[2-methoxy-5-[[2-methoxyethyl(naphthalene-2-carbonyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3956678) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl(naphthalene-2-carbonyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl(naphthalene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3956678 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl(naphthalene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25NO6S/c1-28-13-12-24(23(25)20-10-9-18-6-4-5-7-19(18)15-20)16-17-8-11-21(29-2)22(14-17)30-31(3,26)27/h4-11,14-15H,12-13,16H2,1-3H3 |
| InChIKey | RXWZYGBIWWMIHJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|