C21H27NO8S — CID 4543503
[5-[[(3,5-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 4543503) has the molecular formula C21H27NO8S and a molecular weight of 453.51 g/mol. Its IUPAC name is [5-[[(3,5-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(3,5-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 4543503 |
| Molecular Formula | C21H27NO8S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [5-[[(3,5-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO8S/c1-26-9-8-22(21(23)16-11-17(27-2)13-18(12-16)28-3)14-15-6-7-19(29-4)20(10-15)30-31(5,24)25/h6-7,10-13H,8-9,14H2,1-5H3 |
| InChIKey | ZTXIRZRRZLMNHD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|